EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22O5/c1-13(2)4-10-16-18(24)12-19(26-3)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-9,11-12,22,24-25H,10H2,1-3H3/b11-7+ |
| InChIKey | ORXQGKIUCDPEAJ-YRNVUSSQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | |||
| - | PubMed (15679315) | ||
| cone (BTO:0000280) | PubMed (22111577) | EtOH extract of hop cones |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.20 (diacylglycerol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of diacylglycerol O-acyltransferase (EC 2.3.1.20). antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthohumol (CHEBI:66331) has role anti-HIV-1 agent (CHEBI:64947) |
| xanthohumol (CHEBI:66331) has role antineoplastic agent (CHEBI:35610) |
| xanthohumol (CHEBI:66331) has role antiviral agent (CHEBI:22587) |
| xanthohumol (CHEBI:66331) has role apoptosis inducer (CHEBI:68495) |
| xanthohumol (CHEBI:66331) has role EC 2.3.1.20 (diacylglycerol O-acyltransferase) inhibitor (CHEBI:64919) |
| xanthohumol (CHEBI:66331) has role metabolite (CHEBI:25212) |
| xanthohumol (CHEBI:66331) is a aromatic ether (CHEBI:35618) |
| xanthohumol (CHEBI:66331) is a chalcones (CHEBI:23086) |
| xanthohumol (CHEBI:66331) is a polyphenol (CHEBI:26195) |
| xanthohumol (CHEBI:66331) is conjugate acid of xanthohumol(1−) (CHEBI:134289) |
| Incoming Relation(s) |
| xanthohumol(1−) (CHEBI:134289) is conjugate base of xanthohumol (CHEBI:66331) |
| IUPAC Name |
|---|
| (2E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 2',4,4'-trihydroxy-6'-methoxy-3'-prenylchalcone | ChEBI |
| UniProt Name | Source |
|---|---|
| xanthohumol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00007099 | KNApSAcK |
| C16417 | KEGG COMPOUND |
| CPD-7119 | MetaCyc |
| EP2579862 | Patent |
| HMDB0037479 | HMDB |
| LMPK12120294 | LIPID MAPS |
| WO2009126320 | Patent |
| Xanthohumol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2226282 | Reaxys |
| CAS:6754-58-1 | ChemIDplus |
| CAS:6754-58-1 | KEGG COMPOUND |
| Citations |
|---|