EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1cc(O)c(CC=C(C)C)c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22O5/c1-13(2)4-10-16-18(24)12-19(26-3)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-9,11-12,22,24-25H,10H2,1-3H3/b11-7+ |
| InChIKey | ORXQGKIUCDPEAJ-YRNVUSSQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | |||
| - | PubMed (15679315) | ||
| cone (BTO:0000280) | PubMed (22111577) | EtOH extract of hop cones |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.3.1.20 (diacylglycerol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of diacylglycerol O-acyltransferase (EC 2.3.1.20). antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthohumol (CHEBI:66331) has role anti-HIV-1 agent (CHEBI:64947) |
| xanthohumol (CHEBI:66331) has role antineoplastic agent (CHEBI:35610) |
| xanthohumol (CHEBI:66331) has role antiviral agent (CHEBI:22587) |
| xanthohumol (CHEBI:66331) has role apoptosis inducer (CHEBI:68495) |
| xanthohumol (CHEBI:66331) has role EC 2.3.1.20 (diacylglycerol O-acyltransferase) inhibitor (CHEBI:64919) |
| xanthohumol (CHEBI:66331) has role metabolite (CHEBI:25212) |
| xanthohumol (CHEBI:66331) is a aromatic ether (CHEBI:35618) |
| xanthohumol (CHEBI:66331) is a chalcones (CHEBI:23086) |
| xanthohumol (CHEBI:66331) is a polyphenol (CHEBI:26195) |
| xanthohumol (CHEBI:66331) is conjugate acid of xanthohumol(1−) (CHEBI:134289) |
| Incoming Relation(s) |
| xanthohumol(1−) (CHEBI:134289) is conjugate base of xanthohumol (CHEBI:66331) |
| IUPAC Name |
|---|
| (2E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2',4,4'-trihydroxy-6'-methoxy-3'-prenylchalcone | ChEBI |
| Xantho-flav | ChEMBL |
| Xanthohumol | ChEMBL |
| UniProt Name | Source |
|---|---|
| xanthohumol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00007099 | KNApSAcK |
| C16417 | KEGG COMPOUND |
| CPD-7119 | MetaCyc |
| EP2579862 | Patent |
| HMDB0037479 | HMDB |
| LMPK12120294 | LIPID MAPS |
| WO2009126320 | Patent |
| Xanthohumol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2226282 | Reaxys |
| CAS:6754-58-1 | KEGG COMPOUND |
| CAS:6754-58-1 | ChemIDplus |
| Citations |
|---|