EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34N2 |
| Net Charge | 0 |
| Average Mass | 314.517 |
| Monoisotopic Mass | 314.27220 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]45C=N[C@@H](C)[C@@]4([H])CC[C@@]35[H])[C@@]1(C)CC[C@H](N)C2 |
| InChI | InChI=1S/C21H34N2/c1-13-17-5-6-19-16-4-3-14-11-15(22)7-9-20(14,2)18(16)8-10-21(17,19)12-23-13/h12-19H,3-11,22H2,1-2H3/t13-,14-,15-,16+,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | OWJXANQNZAVDIW-XLVUHOLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wrightia javanica (ncbitaxon:82855-1) | leaf (BTO:0000713) | PubMed (12808258) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wrightiamine A (CHEBI:66330) has role antineoplastic agent (CHEBI:35610) |
| wrightiamine A (CHEBI:66330) has role metabolite (CHEBI:25212) |
| wrightiamine A (CHEBI:66330) is a organic heteropentacyclic compound (CHEBI:38164) |
| wrightiamine A (CHEBI:66330) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| wrightiamine A (CHEBI:66330) is a primary amino compound (CHEBI:50994) |
| wrightiamine A (CHEBI:66330) is a steroid alkaloid (CHEBI:26767) |
| IUPAC Name |
|---|
| (3S,3aS,5aS,5bR,7aS,9S,11aS,11bS,13aR)-3,11a-dimethyl-3a,4,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13-hexadecahydro-3H-naphtho[2',1':4,5]indeno[1,7a-c]pyrrol-9-amine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9438722 | Reaxys |
| Citations |
|---|