EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5O5 |
| Net Charge | 0 |
| Average Mass | 367.406 |
| Monoisotopic Mass | 367.18557 |
| SMILES | CCC(C)[C@H](NC(=O)[C@H]1O[C@@H]1C(=O)O)C(=O)NCCCc1cnc(N)n1 |
| InChI | InChI=1S/C16H25N5O5/c1-3-8(2)10(21-14(23)11-12(26-11)15(24)25)13(22)18-6-4-5-9-7-19-16(17)20-9/h7-8,10-12H,3-6H2,1-2H3,(H,18,22)(H,21,23)(H,24,25)(H3,17,19,20)/t8?,10-,11-,12-/m0/s1 |
| InChIKey | DCFQVVMHERPAGJ-GIQBOEGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aphanoascus fulvescens (ncbitaxon:73174) | - | PubMed (10908107) | Strain: 14865 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cathepsin L (EC 3.4.22.15) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor which interferes with the action of cathepsin L (EC 3.4.22.15). cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WF14865A (CHEBI:66322) has role cathepsin B inhibitor (CHEBI:64932) |
| WF14865A (CHEBI:66322) has role cathepsin L (EC 3.4.22.15) inhibitor (CHEBI:70821) |
| WF14865A (CHEBI:66322) has role fungal metabolite (CHEBI:76946) |
| WF14865A (CHEBI:66322) is a dicarboxylic acid monoamide (CHEBI:35735) |
| WF14865A (CHEBI:66322) is a epoxide (CHEBI:32955) |
| WF14865A (CHEBI:66322) is a guanidines (CHEBI:24436) |
| WF14865A (CHEBI:66322) is a imidazoles (CHEBI:24780) |
| WF14865A (CHEBI:66322) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S,3S)-3-{[(2R)-1-{[3-(2-amino-1H-imidazol-4-yl)propyl]amino}-3-methyl-1-oxopentan-2-yl]carbamoyl}oxirane-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 4-[3-[N-[[(2S,3S)-3-trans-carboxyoxiran-2-yl]carbonyl]-L-isoleucyl]aminopropanyl]-1H-imidazol-2-yl amine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8652543 | Reaxys |
| Citations |
|---|