EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O6 |
| Net Charge | 0 |
| Average Mass | 504.708 |
| Monoisotopic Mass | 504.34509 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)[C@H](O)[C@@H](O)[C@@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O6/c1-16-9-12-30(25(35)36)14-13-27(4)18(21(30)17(16)2)7-8-20-28(27,5)11-10-19-26(3,15-31)23(33)22(32)24(34)29(19,20)6/h7,16-17,19-24,31-34H,8-15H2,1-6H3,(H,35,36)/t16-,17+,19+,20+,21+,22+,23-,24-,26+,27-,28-,29+,30+/m1/s1 |
| InChIKey | NFPZOORPDJBGME-BLOZSHLCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Weigela subsessilis (ncbitaxon:79620) | |||
| stem (BTO:0001300) | PubMed (16595930) | ||
| leaf (BTO:0000713) | PubMed (16595930) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| weigelic acid (CHEBI:66321) has parent hydride ursane (CHEBI:35711) |
| weigelic acid (CHEBI:66321) has role metabolite (CHEBI:25212) |
| weigelic acid (CHEBI:66321) is a monocarboxylic acid (CHEBI:25384) |
| weigelic acid (CHEBI:66321) is a pentacyclic triterpenoid (CHEBI:25872) |
| weigelic acid (CHEBI:66321) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1β,2α,3α)-1,2,3,23-tetrahydroxyurs-12-en-28-oic acid |
| Manual Xrefs | Databases |
|---|---|
| 8777001 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10508037 | Reaxys |
| Citations |
|---|