EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O6 |
| Net Charge | 0 |
| Average Mass | 388.460 |
| Monoisotopic Mass | 388.18859 |
| SMILES | COc1cc2c(c(O)c1OC)-c1c(cc(O)c(OC)c1OC)CC(C)C(C)C2 |
| InChI | InChI=1S/C22H28O6/c1-11-7-13-9-15(23)20(26-4)22(28-6)18(13)17-14(8-12(11)2)10-16(25-3)21(27-5)19(17)24/h9-12,23-24H,7-8H2,1-6H3 |
| InChIKey | YTAKUZMOQQARQX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra rubriflora (ncbitaxon:124791) | fruit (BTO:0000486) | PubMed (17190445) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rubrisandrin A(2:1 Inseparable mixture of regeoisomers) (CHEBI:66320) has role metabolite (CHEBI:25212) |
| Rubrisandrin A(2:1 Inseparable mixture of regeoisomers) (CHEBI:66320) is a tannin (CHEBI:26848) |
| Citations |
|---|