EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30O6 |
| Net Charge | 0 |
| Average Mass | 462.542 |
| Monoisotopic Mass | 462.20424 |
| SMILES | [H][C@@]12CC(=O)O[C@@]13Cc1ccc4c(c1C=C[C@@]3([H])C(C)(C)O2)C[C@@]1([H])O[C@]([H])([C@]2([H])C=C(C)C(=O)O2)[C@@H](C)[C@@]41[H] |
| InChI | InChI=1S/C28H30O6/c1-13-9-20(32-26(13)30)25-14(2)24-17-6-5-15-12-28-21(8-7-16(15)18(17)10-19(24)31-25)27(3,4)33-22(28)11-23(29)34-28/h5-9,14,19-22,24-25H,10-12H2,1-4H3/t14-,19+,20-,21-,22+,24-,25-,28+/m0/s1 |
| InChIKey | JGSLSHOXBXVVTQ-NEUKEVNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra rubriflora (ncbitaxon:124791) | |||
| leaf (BTO:0000713) | PubMed (16494492) | ||
| stem (BTO:0001300) | PubMed (16494492) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubriflordilactone B (CHEBI:66319) has role anti-HIV-1 agent (CHEBI:64947) |
| rubriflordilactone B (CHEBI:66319) has role metabolite (CHEBI:25212) |
| rubriflordilactone B (CHEBI:66319) is a cyclic ether (CHEBI:37407) |
| rubriflordilactone B (CHEBI:66319) is a hexacyclic triterpenoid (CHEBI:70994) |
| rubriflordilactone B (CHEBI:66319) is a terpene lactone (CHEBI:37668) |
| rubriflordilactone B (CHEBI:66319) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2aR,5aR,8bS,9S,10S,11aR,14aS)-1,1,9-trimethyl-10-[(2S)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]-1,2a,3,6,8b,9,10,11a,12,14a-decahydro-4H-furo[3,2-b]furo[3'',2'':1',2']indeno[4',5':5,6]cyclohepta[1,2-c]furan-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10308906 | Reaxys |
| Citations |
|---|