EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O6 |
| Net Charge | 0 |
| Average Mass | 410.466 |
| Monoisotopic Mass | 410.17294 |
| SMILES | COc1c(O)cc2oc3cc(O)cc(O)c3c(=O)c2c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H26O6/c1-13(2)6-5-7-14(3)8-9-16-21-20(12-18(27)24(16)29-4)30-19-11-15(25)10-17(26)22(19)23(21)28/h6,8,10-12,25-27H,5,7,9H2,1-4H3/b14-8+ |
| InChIKey | JLTSTSRANGPLOQ-RIYZIHGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allanblackia monticola (IPNI:427045-1) | stem (BTO:0001300) | PubMed (16394561) | Previous component: stem bark; |
| Garcinia cowa (ncbitaxon:180103) | - | DOI (10.1071/CH03175) | |
| Garcinia dioica (IPNI:427925-1) | - | PubMed (8887739) | |
| Garcinia merguensis (IPNI:428083-1) | xylem (BTO:0001468) | PubMed (18523924) | Previous component: wood; |
| Garcinia parvifolia (ncbitaxon:180113) | - | PubMed (12494345) | |
| Mesua (ncbitaxon:114078) | stem (BTO:0001300) | Article (NAT PROD SCI,2006,12,138) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubraxanthone (CHEBI:66318) has role antibacterial agent (CHEBI:33282) |
| rubraxanthone (CHEBI:66318) has role antineoplastic agent (CHEBI:35610) |
| rubraxanthone (CHEBI:66318) has role metabolite (CHEBI:25212) |
| rubraxanthone (CHEBI:66318) is a aromatic ether (CHEBI:35618) |
| rubraxanthone (CHEBI:66318) is a polyphenol (CHEBI:26195) |
| rubraxanthone (CHEBI:66318) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,6,8-trihydroxy-2-methoxy-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1607002 | Reaxys |
| CAS:65411-01-0 | ChemIDplus |
| Citations |
|---|