EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O6 |
| Net Charge | 0 |
| Average Mass | 410.466 |
| Monoisotopic Mass | 410.17294 |
| SMILES | COc1c(O)cc2oc3cc(O)cc(O)c3c(=O)c2c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H26O6/c1-13(2)6-5-7-14(3)8-9-16-21-20(12-18(27)24(16)29-4)30-19-11-15(25)10-17(26)22(19)23(21)28/h6,8,10-12,25-27H,5,7,9H2,1-4H3/b14-8+ |
| InChIKey | JLTSTSRANGPLOQ-RIYZIHGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allanblackia monticola (IPNI:427045-1) | stem (BTO:0001300) | PubMed (16394561) | Previous component: stem bark; |
| Garcinia cowa (ncbitaxon:180103) | - | DOI (10.1071/CH03175) | |
| Garcinia dioica (IPNI:427925-1) | - | PubMed (8887739) | |
| Garcinia merguensis (IPNI:428083-1) | xylem (BTO:0001468) | PubMed (18523924) | Previous component: wood; |
| Garcinia parvifolia (ncbitaxon:180113) | - | PubMed (12494345) | |
| Mesua (ncbitaxon:114078) | stem (BTO:0001300) | Article (NAT PROD SCI,2006,12,138) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubraxanthone (CHEBI:66318) has role antibacterial agent (CHEBI:33282) |
| rubraxanthone (CHEBI:66318) has role antineoplastic agent (CHEBI:35610) |
| rubraxanthone (CHEBI:66318) has role metabolite (CHEBI:25212) |
| rubraxanthone (CHEBI:66318) is a aromatic ether (CHEBI:35618) |
| rubraxanthone (CHEBI:66318) is a polyphenol (CHEBI:26195) |
| rubraxanthone (CHEBI:66318) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,6,8-trihydroxy-2-methoxy-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1607002 | Reaxys |
| CAS:65411-01-0 | ChemIDplus |
| Citations |
|---|