EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H76O17 |
| Net Charge | 0 |
| Average Mass | 913.108 |
| Monoisotopic Mass | 912.50825 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]2([H])O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]2([H])O[C@H]2CC[C@]3(C)[C@@]4([H])C=C[C@]56OC[C@@]7(CC[C@@H](C)[C@H](C)[C@]75[H])[C@H](O)C[C@@]6(C)[C@]4(C)CC[C@@]3([H])C2(C)C)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C47H76O17/c1-21-8-14-46-20-59-47(38(46)22(21)2)15-10-27-43(5)12-11-29(42(3,4)26(43)9-13-44(27,6)45(47,7)16-28(46)51)62-40-36(33(55)31(53)24(17-48)60-40)64-41-37(34(56)32(54)25(18-49)61-41)63-39-35(57)30(52)23(50)19-58-39/h10,15,21-41,48-57H,8-9,11-14,16-20H2,1-7H3/t21-,22+,23-,24-,25-,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36-,37-,38-,39+,40+,41+,43+,44-,45+,46+,47+/m1/s1 |
| InChIKey | OERYSJKYOLNHAD-NCFQBMSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bupleurum rotundifolium (ncbitaxon:90446) | fruit (BTO:0000486) | PubMed (12672986) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rotundifolioside A (CHEBI:66314) has parent hydride ursane (CHEBI:35711) |
| rotundifolioside A (CHEBI:66314) has role antineoplastic agent (CHEBI:35610) |
| rotundifolioside A (CHEBI:66314) has role plant metabolite (CHEBI:76924) |
| rotundifolioside A (CHEBI:66314) is a bridged compound (CHEBI:35990) |
| rotundifolioside A (CHEBI:66314) is a cyclic ether (CHEBI:37407) |
| rotundifolioside A (CHEBI:66314) is a hexacyclic triterpenoid (CHEBI:70994) |
| rotundifolioside A (CHEBI:66314) is a trisaccharide derivative (CHEBI:63571) |
| rotundifolioside A (CHEBI:66314) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (3β,16α)-16-hydroxy-13,28-epoxyurs-11-en-3-yl β-D-xylopyranosyl-(1→2)-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 13β,28-epoxy-16α-hydroxyurs-11-en-3β-yl β-D-xylopyranosyl-(1→2)-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside | ChEBI |
| Citations |
|---|