EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O8S2 |
| Net Charge | 0 |
| Average Mass | 484.552 |
| Monoisotopic Mass | 484.09741 |
| SMILES | [H][C@]12C[C@@]34SS[C@]5(C[C@]6([H])C(=O)C[C@H](OC)[C@H](O)[C@]6([H])N5C3=O)C(=O)N4[C@@]1([H])[C@@H](O)[C@@H](OC)CC2=O |
| InChI | InChI=1S/C20H24N2O8S2/c1-29-11-3-9(23)7-5-19-18(28)22-14-8(10(24)4-12(30-2)16(14)26)6-20(22,32-31-19)17(27)21(19)13(7)15(11)25/h7-8,11-16,25-26H,3-6H2,1-2H3/t7-,8-,11+,12+,13-,14-,15+,16+,19-,20-/m1/s1 |
| InChIKey | WZZFRBNMRXVFNQ-UDLXUQTMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Exserohilum rostratum (ncbitaxon:132102) | - | PubMed (15332857) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rostratin C (CHEBI:66312) has role antineoplastic agent (CHEBI:35610) |
| rostratin C (CHEBI:66312) has role metabolite (CHEBI:25212) |
| rostratin C (CHEBI:66312) is a bridged compound (CHEBI:35990) |
| rostratin C (CHEBI:66312) is a cyclic ketone (CHEBI:3992) |
| rostratin C (CHEBI:66312) is a diol (CHEBI:23824) |
| rostratin C (CHEBI:66312) is a ether (CHEBI:25698) |
| rostratin C (CHEBI:66312) is a lactam (CHEBI:24995) |
| rostratin C (CHEBI:66312) is a organic disulfide (CHEBI:35489) |
| rostratin C (CHEBI:66312) is a organic heterohexacyclic compound (CHEBI:51914) |
| rostratin C (CHEBI:66312) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,4R,4aR,6aR,7aS,10S,11R,11aR,13aR,14aS)-4,11-dihydroxy-3,10-dimethoxydecahydro-1H,7H-6a,13a-epidithiopyrazino[1,2-a:4,5-a']diindole-1,6,8,13(7aH)-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 9423742 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10738615 | Reaxys |
| Citations |
|---|