EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O6S2 |
| Net Charge | 0 |
| Average Mass | 428.532 |
| Monoisotopic Mass | 428.10758 |
| SMILES | [H][C@@]12[C@@H](O)CC[C@H](O)[C@@]1([H])C[C@@]13SS[C@]4(C[C@]5([H])[C@@H](O)CC[C@H](O)[C@@]5([H])N4C1=O)C(=O)N23 |
| InChI | InChI=1S/C18H24N2O6S2/c21-9-1-3-11(23)13-7(9)5-17-15(25)20-14-8(10(22)2-4-12(14)24)6-18(20,28-27-17)16(26)19(13)17/h7-14,21-24H,1-6H2/t7-,8-,9+,10+,11+,12+,13+,14+,17-,18-/m1/s1 |
| InChIKey | UJDXMQJEYGMBMN-FQPNBHNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Exserohilum rostratum (ncbitaxon:132102) | - | PubMed (15332857) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rostratin A (CHEBI:66310) has role antineoplastic agent (CHEBI:35610) |
| rostratin A (CHEBI:66310) has role metabolite (CHEBI:25212) |
| rostratin A (CHEBI:66310) is a bridged compound (CHEBI:35990) |
| rostratin A (CHEBI:66310) is a lactam (CHEBI:24995) |
| rostratin A (CHEBI:66310) is a organic disulfide (CHEBI:35489) |
| rostratin A (CHEBI:66310) is a organic heterohexacyclic compound (CHEBI:51914) |
| rostratin A (CHEBI:66310) is a secondary alcohol (CHEBI:35681) |
| rostratin A (CHEBI:66310) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1S,4S,4aS,6aR,7aS,8S,11S,11aS,13aR,14aS)-1,4,8,11-tetrahydroxydodecahydro-1H,7H-6a,13a-epidithiopyrazino[1,2-a:4,5-a']diindole-6,13-dione |
| Manual Xrefs | Databases |
|---|---|
| 9468276 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10739225 | Reaxys |
| Citations |
|---|