EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6631 - maculosin
| Formula | C14H16N2O3 |
| Net Charge | 0 |
| Average Mass | 260.293 |
| Monoisotopic Mass | 260.11609 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C14H16N2O3/c17-10-5-3-9(4-6-10)8-11-14(19)16-7-1-2-12(16)13(18)15-11/h3-6,11-12,17H,1-2,7-8H2,(H,15,18)/t11-,12-/m0/s1 |
| InChIKey | LSGOTAXPWMCUCK-RYUDHWBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maculosin (CHEBI:6631) has functional parent L-proline (CHEBI:17203) |
| maculosin (CHEBI:6631) has functional parent L-tyrosine (CHEBI:17895) |
| maculosin (CHEBI:6631) has role metabolite (CHEBI:25212) |
| maculosin (CHEBI:6631) is a dipeptide (CHEBI:46761) |
| maculosin (CHEBI:6631) is a homodetic cyclic peptide (CHEBI:24613) |
| maculosin (CHEBI:6631) is a phenols (CHEBI:33853) |
| maculosin (CHEBI:6631) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-(4-hydroxybenzyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonyms | Source |
|---|---|
| Cyclo(L-Pro-L-Tyr) | KEGG COMPOUND |
| CYCLO-(L-TYROSINE-L-PROLINE) INHIBITOR | PDBeChem |
| Citations |
|---|