EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31NO7 |
| Net Charge | 0 |
| Average Mass | 505.567 |
| Monoisotopic Mass | 505.21005 |
| SMILES | COc1ccc([C@@]23Oc4cc(OC)cc(OC)c4[C@]2(O)[C@H](O)[C@H](C(=O)N(C)C)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31NO7/c1-30(2)27(32)23-24(17-9-7-6-8-10-17)29(18-11-13-19(34-3)14-12-18)28(33,26(23)31)25-21(36-5)15-20(35-4)16-22(25)37-29/h6-16,23-24,26,31,33H,1-5H3/t23-,24-,26-,28+,29+/m1/s1 |
| InChIKey | DAPAQENNNINUPW-IDAMAFBJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia duperreana (IPNI:577056-1) | root (BTO:0001188) | DOI (10.1021/np990242g) | |
| Aglaia elliptifolia (IPNI:577069-1) | |||
| root (BTO:0001188) | DOI (10.1039/C39820001150) | ||
| stem (BTO:0001300) | DOI (10.1039/C39820001150) | ||
| Aglaia odorata (ncbitaxon:210347) | leaf (BTO:0000713) | DOI (10.1016/S0031-9422(00)94986-0) |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rocaglamide (CHEBI:66309) has role antileishmanial agent (CHEBI:70868) |
| rocaglamide (CHEBI:66309) has role antineoplastic agent (CHEBI:35610) |
| rocaglamide (CHEBI:66309) has role metabolite (CHEBI:25212) |
| rocaglamide (CHEBI:66309) is a monocarboxylic acid amide (CHEBI:29347) |
| rocaglamide (CHEBI:66309) is a monomethoxybenzene (CHEBI:25235) |
| rocaglamide (CHEBI:66309) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-N,N-dimethyl-3-phenyl-2,3,3a,8b-tetrahydro-1H-benzo[b]cyclopenta[d]furan-2-carboxamide |
| Synonym | Source |
|---|---|
| (−)-(1α,2α,3β,3aβ,8bβ)-2,3,3a,8b-tetrahydro-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-N,N-dimethyl-3-phenyl-1H-cyclopenta(b)benzofuran-2-carboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2009082371 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4219080 | Reaxys |
| CAS:84573-16-0 | ChemIDplus |
| Citations |
|---|