EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O7 |
| Net Charge | 0 |
| Average Mass | 408.406 |
| Monoisotopic Mass | 408.12090 |
| SMILES | CC(C)(COC(=O)c1ccc2c(c1)OCO2)CC1=C(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H20O7/c1-23(2,11-28-22(27)13-7-8-17-18(9-13)30-12-29-17)10-16-19(24)14-5-3-4-6-15(14)20(25)21(16)26/h3-9,26H,10-12H2,1-2H3 |
| InChIKey | QWHPVCGUVBLEQF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhinacanthus nasutus (ncbitaxon:537489) | - | PubMed (8792629) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhinacanthin D (CHEBI:66304) has role anti-allergic agent (CHEBI:50857) |
| rhinacanthin D (CHEBI:66304) has role antiviral agent (CHEBI:22587) |
| rhinacanthin D (CHEBI:66304) has role metabolite (CHEBI:25212) |
| rhinacanthin D (CHEBI:66304) is a benzodioxoles (CHEBI:38298) |
| rhinacanthin D (CHEBI:66304) is a carboxylic ester (CHEBI:33308) |
| rhinacanthin D (CHEBI:66304) is a enol (CHEBI:33823) |
| rhinacanthin D (CHEBI:66304) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| IUPAC Name |
|---|
| 3-(3-hydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-2,2-dimethylpropyl 1,3-benzodioxole-5-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7726066 | Reaxys |
| CAS:179461-46-2 | ChemIDplus |
| Citations |
|---|