EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O5 |
| Net Charge | 0 |
| Average Mass | 410.510 |
| Monoisotopic Mass | 410.20932 |
| SMILES | C/C=C(\C)CC/C=C(\C)C(=O)OCC(C)(C)CC1=C(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H30O5/c1-6-16(2)10-9-11-17(3)24(29)30-15-25(4,5)14-20-21(26)18-12-7-8-13-19(18)22(27)23(20)28/h6-8,11-13,28H,9-10,14-15H2,1-5H3/b16-6+,17-11+ |
| InChIKey | HBWJZSWEQJLURT-QIGLBIQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhinacanthus nasutus (ncbitaxon:537489) | - | PubMed (8792629) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhinacanthin C (CHEBI:66303) has role antineoplastic agent (CHEBI:35610) |
| rhinacanthin C (CHEBI:66303) has role antiviral agent (CHEBI:22587) |
| rhinacanthin C (CHEBI:66303) has role metabolite (CHEBI:25212) |
| rhinacanthin C (CHEBI:66303) is a carboxylic ester (CHEBI:33308) |
| rhinacanthin C (CHEBI:66303) is a enoate ester (CHEBI:51702) |
| rhinacanthin C (CHEBI:66303) is a enol (CHEBI:33823) |
| rhinacanthin C (CHEBI:66303) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| IUPAC Name |
|---|
| 3-(3-hydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-2,2-dimethylpropyl (2E,6E)-2,6-dimethylocta-2,6-dienoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7391477 | Reaxys |
| Citations |
|---|