EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O6 |
| Net Charge | 0 |
| Average Mass | 392.407 |
| Monoisotopic Mass | 392.12599 |
| SMILES | CC1(C)C=Cc2c(cc3oc4c(O)c5c(cc4c(=O)c3c2O)C=CC(C)(C)O5)O1 |
| InChI | InChI=1S/C23H20O6/c1-22(2)8-6-12-14(28-22)10-15-16(17(12)24)18(25)13-9-11-5-7-23(3,4)29-20(11)19(26)21(13)27-15/h5-10,24,26H,1-4H3 |
| InChIKey | ZMJXZBDITYZMTK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum blancoi (ncbitaxon:667324) | root (BTO:0001188) | PubMed (15684529) | |
| Garcinia densivenia (IPNI:427919-1) | stem (BTO:0001300) | DOI (10.1016/S0031-9422(00)83950-3) | Previous component: stem bark; |
| Rheedia gardneriana (ncbitaxon:469955) | root (BTO:0001188) | DOI (10.1016/S0031-9422(00)83485-8) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyranojacareubin (CHEBI:66302) has role antiviral agent (CHEBI:22587) |
| pyranojacareubin (CHEBI:66302) has role metabolite (CHEBI:25212) |
| pyranojacareubin (CHEBI:66302) is a cyclic ether (CHEBI:37407) |
| pyranojacareubin (CHEBI:66302) is a cyclic ketone (CHEBI:3992) |
| pyranojacareubin (CHEBI:66302) is a organic heteropentacyclic compound (CHEBI:38164) |
| pyranojacareubin (CHEBI:66302) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 5,12-dihydroxy-2,2,10,10-tetramethyl-2H,6H,10H-dipyrano[3,2-b:2',3'-i]xanthen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6352609 | Reaxys |
| Citations |
|---|