EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H51N3O13 |
| Net Charge | 0 |
| Average Mass | 733.812 |
| Monoisotopic Mass | 733.34219 |
| SMILES | [H][C@@]1([C@@H](C)CC)OC(=O)[C@H](C)OC(=O)[C@@H](NC(=O)c2cccc(NC=O)c2O)[C@@H](C)OC(=O)[C@H](C(C)C)OC(=O)C(C)(C)C(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C36H51N3O13/c1-11-19(6)28-31(44)38-24(15-17(2)3)29(42)36(9,10)35(48)52-27(18(4)5)34(47)49-20(7)25(33(46)50-21(8)32(45)51-28)39-30(43)22-13-12-14-23(26(22)41)37-16-40/h12-14,16-21,24-25,27-28,41H,11,15H2,1-10H3,(H,37,40)(H,38,44)(H,39,43)/t19-,20+,21-,24-,25-,27-,28-/m0/s1 |
| InChIKey | NBVBHNUFSYRTEN-YUZPYZPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora (ncbitaxon:2063) | - | PubMed (17608530) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclodepsipeptide 2 (CHEBI:66300) has role antineoplastic agent (CHEBI:35610) |
| cyclodepsipeptide 2 (CHEBI:66300) has role metabolite (CHEBI:25212) |
| cyclodepsipeptide 2 (CHEBI:66300) is a benzamides (CHEBI:22702) |
| cyclodepsipeptide 2 (CHEBI:66300) is a cyclodepsipeptide (CHEBI:35213) |
| cyclodepsipeptide 2 (CHEBI:66300) is a formamides (CHEBI:24079) |
| cyclodepsipeptide 2 (CHEBI:66300) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-[(2S,5S,8S,13S,16R,17S)-5-[(2S)-butan-2-yl]-2,10,10,16-tetramethyl-8-(2-methylpropyl)-3,6,9,11,14,18-hexaoxo-13-(propan-2-yl)-1,4,12,15-tetraoxa-7-azacyclooctadecan-17-yl]-3-(formylamino)-2-hydroxybenzamide |
| Citations |
|---|