EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H53N3O13 |
| Net Charge | 0 |
| Average Mass | 747.839 |
| Monoisotopic Mass | 747.35784 |
| SMILES | [H][C@@]1(C(C)CC)OC(=O)[C@H](C)OC(=O)[C@@H](NC(=O)c2cccc(NC=O)c2O)[C@@H](C)OC(=O)[C@H](CC(C)C)OC(=O)C(C)(C)C(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C37H53N3O13/c1-11-20(6)29-32(45)39-25(15-18(2)3)30(43)37(9,10)36(49)52-26(16-19(4)5)34(47)50-21(7)27(35(48)51-22(8)33(46)53-29)40-31(44)23-13-12-14-24(28(23)42)38-17-41/h12-14,17-22,25-27,29,42H,11,15-16H2,1-10H3,(H,38,41)(H,39,45)(H,40,44)/t20?,21-,22+,25+,26+,27+,29+/m1/s1 |
| InChIKey | HJNZTHHOZWMVPB-WCSXKIRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora (ncbitaxon:2063) | - | PubMed (17608530) | |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8501018) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| respirantin (CHEBI:66299) has role antimicrobial agent (CHEBI:33281) |
| respirantin (CHEBI:66299) has role antineoplastic agent (CHEBI:35610) |
| respirantin (CHEBI:66299) has role metabolite (CHEBI:25212) |
| respirantin (CHEBI:66299) is a benzamides (CHEBI:22702) |
| respirantin (CHEBI:66299) is a cyclodepsipeptide (CHEBI:35213) |
| respirantin (CHEBI:66299) is a formamides (CHEBI:24079) |
| respirantin (CHEBI:66299) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-[(2S,5S,8S,13S,16R,17S)-5-(butan-2-yl)-2,10,10,16-tetramethyl-8,13-bis(2-methylpropyl)-3,6,9,11,14,18-hexaoxo-1,4,12,15-tetraoxa-7-azacyclooctadecan-17-yl]-3-(formylamino)-2-hydroxybenzamide |
| Synonym | Source |
|---|---|
| cyclodepsipeptide 1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2008151306 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11184596 | Reaxys |
| Citations |
|---|