EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H53N3O13 |
| Net Charge | 0 |
| Average Mass | 747.839 |
| Monoisotopic Mass | 747.35784 |
| SMILES | [H][C@@]1(C(C)CC)OC(=O)[C@H](C)OC(=O)[C@@H](NC(=O)c2cccc(NC=O)c2O)[C@@H](C)OC(=O)[C@H](CC(C)C)OC(=O)C(C)(C)C(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C37H53N3O13/c1-11-20(6)29-32(45)39-25(15-18(2)3)30(43)37(9,10)36(49)52-26(16-19(4)5)34(47)50-21(7)27(35(48)51-22(8)33(46)53-29)40-31(44)23-13-12-14-24(28(23)42)38-17-41/h12-14,17-22,25-27,29,42H,11,15-16H2,1-10H3,(H,38,41)(H,39,45)(H,40,44)/t20?,21-,22+,25+,26+,27+,29+/m1/s1 |
| InChIKey | HJNZTHHOZWMVPB-WCSXKIRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora (ncbitaxon:2063) | - | PubMed (17608530) | |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (8501018) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| respirantin (CHEBI:66299) has role antimicrobial agent (CHEBI:33281) |
| respirantin (CHEBI:66299) has role antineoplastic agent (CHEBI:35610) |
| respirantin (CHEBI:66299) has role metabolite (CHEBI:25212) |
| respirantin (CHEBI:66299) is a benzamides (CHEBI:22702) |
| respirantin (CHEBI:66299) is a cyclodepsipeptide (CHEBI:35213) |
| respirantin (CHEBI:66299) is a formamides (CHEBI:24079) |
| respirantin (CHEBI:66299) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-[(2S,5S,8S,13S,16R,17S)-5-(butan-2-yl)-2,10,10,16-tetramethyl-8,13-bis(2-methylpropyl)-3,6,9,11,14,18-hexaoxo-1,4,12,15-tetraoxa-7-azacyclooctadecan-17-yl]-3-(formylamino)-2-hydroxybenzamide |
| Synonym | Source |
|---|---|
| cyclodepsipeptide 1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2008151306 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11184596 | Reaxys |
| Citations |
|---|