EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | C=C(C)CC[C@H](Cc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1)CC2=O)C(=C)C |
| InChI | InChI=1S/C25H28O5/c1-14(2)5-6-17(15(3)4)11-19-20(27)12-21(28)24-22(29)13-23(30-25(19)24)16-7-9-18(26)10-8-16/h7-10,12,17,23,26-28H,1,3,5-6,11,13H2,2,4H3/t17-,23+/m1/s1 |
| InChIKey | NPTHXJUVZWZDJB-HXOBKFHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physena madagascariensis (ncbitaxon:764924) | leaf (BTO:0000713) | PubMed (10978202) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remangiflavanone A (CHEBI:66297) has role antibacterial agent (CHEBI:33282) |
| remangiflavanone A (CHEBI:66297) has role metabolite (CHEBI:25212) |
| remangiflavanone A (CHEBI:66297) is a 4'-hydroxyflavanones (CHEBI:140331) |
| remangiflavanone A (CHEBI:66297) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2R)-5-methyl-2-(prop-1-en-2-yl)hex-5-en-1-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-5,7,4'-trihydroxy-8-lavandulylflavanone | ChEBI |
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-5-hexen-1-yl]-2,3-dihydro-4H-1-benzopyran-4-one | ChEBI |
| 5,7,2',4'-tetrahydroxy-8-(2-isopropyl-5-methyl-5-hexenyl)flavanone | LIPID MAPS |
| 5,7,4'-trihydroxy-8-(2-isopropyl-5-methyl-5-hexenyl)flavanone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140299 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8658227 | Reaxys |
| Citations |
|---|