EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O5 |
| Net Charge | 0 |
| Average Mass | 408.494 |
| Monoisotopic Mass | 408.19367 |
| SMILES | C=C(C)CC[C@H](Cc1c(O)cc(O)c2c1O[C@H](c1ccc(O)cc1)CC2=O)C(=C)C |
| InChI | InChI=1S/C25H28O5/c1-14(2)5-6-17(15(3)4)11-19-20(27)12-21(28)24-22(29)13-23(30-25(19)24)16-7-9-18(26)10-8-16/h7-10,12,17,23,26-28H,1,3,5-6,11,13H2,2,4H3/t17-,23+/m1/s1 |
| InChIKey | NPTHXJUVZWZDJB-HXOBKFHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physena madagascariensis (ncbitaxon:764924) | leaf (BTO:0000713) | PubMed (10978202) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remangiflavanone A (CHEBI:66297) has role antibacterial agent (CHEBI:33282) |
| remangiflavanone A (CHEBI:66297) has role metabolite (CHEBI:25212) |
| remangiflavanone A (CHEBI:66297) is a 4'-hydroxyflavanones (CHEBI:140331) |
| remangiflavanone A (CHEBI:66297) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2R)-5-methyl-2-(prop-1-en-2-yl)hex-5-en-1-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-5,7,4'-trihydroxy-8-lavandulylflavanone | ChEBI |
| (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-5-hexen-1-yl]-2,3-dihydro-4H-1-benzopyran-4-one | ChEBI |
| 5,7,2',4'-tetrahydroxy-8-(2-isopropyl-5-methyl-5-hexenyl)flavanone | LIPID MAPS |
| 5,7,4'-trihydroxy-8-(2-isopropyl-5-methyl-5-hexenyl)flavanone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140299 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8658227 | Reaxys |
| Citations |
|---|