EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H54O13 |
| Net Charge | 0 |
| Average Mass | 814.925 |
| Monoisotopic Mass | 814.35644 |
| SMILES | [H][C@]12[C@@H]3O[C@]3(CO)[C@@H](O)[C@]3(O)[C@H]4OC(=O)/C=C/C=C\[C@H](OC(=O)c5ccccc5)C5CCC(CC5)C[C@@](C)(O)[C@@]5(O)[C@@H]1O[C@]1(c6ccccc6)O[C@H]5[C@@H](C)[C@]2(O1)[C@]3([H])C[C@@H]4C |
| InChI | InChI=1S/C46H54O13/c1-25-22-32-43(52)35(25)55-33(48)17-11-10-16-31(54-39(49)29-12-6-4-7-13-29)28-20-18-27(19-21-28)23-41(3,51)45(53)36-26(2)44(32)34(37-42(24-47,56-37)40(43)50)38(45)58-46(57-36,59-44)30-14-8-5-9-15-30/h4-17,25-28,31-32,34-38,40,47,50-53H,18-24H2,1-3H3/b16-10-,17-11+/t25-,26+,27?,28?,31-,32+,34-,35-,36-,37-,38+,40+,41+,42-,43+,44-,45-,46-/m0/s1 |
| InChIKey | VAEBJJRRTFBWLJ-JKUKCDQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon reidioides (IPNI:358060-1) | root (BTO:0001188) | PubMed (16204992) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rediocide G (CHEBI:66296) has role antineoplastic agent (CHEBI:35610) |
| rediocide G (CHEBI:66296) has role metabolite (CHEBI:25212) |
| rediocide G (CHEBI:66296) is a benzoate ester (CHEBI:36054) |
| rediocide G (CHEBI:66296) is a diterpenoid (CHEBI:23849) |
| rediocide G (CHEBI:66296) is a epoxide (CHEBI:32955) |
| rediocide G (CHEBI:66296) is a ortho ester (CHEBI:71989) |
| rediocide G (CHEBI:66296) is a terpene lactone (CHEBI:37668) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20035836 | Reaxys |
| Citations |
|---|