EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H56O13 |
| Net Charge | 0 |
| Average Mass | 780.908 |
| Monoisotopic Mass | 780.37209 |
| SMILES | [H][C@@]12CC[C@H](C[C@@](C)(O)[C@@]3(O)[C@@H]4O[C@]5(c6ccccc6)O[C@H]3[C@@H](C)[C@@]3(O5)[C@@]4([H])[C@@H]4O[C@]4(CO)[C@@H](O)[C@]4(O)[C@H](CC[C@]43[H])OC(=O)/C=C/C=C\[C@H]1OC(=O)CC(C)C)[C@@H]2C |
| InChI | InChI=1S/C43H56O13/c1-22(2)19-32(46)51-28-13-9-10-14-31(45)52-30-18-17-29-40(30,49)37(47)39(21-44)35(53-39)33-36-42(50,38(5,48)20-25-15-16-27(28)23(25)3)34-24(4)41(29,33)56-43(54-34,55-36)26-11-7-6-8-12-26/h6-14,22-25,27-30,33-37,44,47-50H,15-21H2,1-5H3/b13-9-,14-10+/t23-,24+,25+,27-,28+,29+,30-,33-,34-,35-,36+,37+,38+,39-,40+,41-,42-,43-/m0/s1 |
| InChIKey | RTYNTVIIQWLHDN-UVJWMBKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon reidioides (IPNI:358060-1) | root (BTO:0001188) | PubMed (16204992) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rediocide E (CHEBI:66294) has role insecticide (CHEBI:24852) |
| rediocide E (CHEBI:66294) has role metabolite (CHEBI:25212) |
| rediocide E (CHEBI:66294) is a diterpenoid (CHEBI:23849) |
| rediocide E (CHEBI:66294) is a epoxide (CHEBI:32955) |
| rediocide E (CHEBI:66294) is a ortho ester (CHEBI:71989) |
| rediocide E (CHEBI:66294) is a terpene lactone (CHEBI:37668) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9983176 | Reaxys |
| Citations |
|---|