EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H58O13 |
| Net Charge | 0 |
| Average Mass | 794.935 |
| Monoisotopic Mass | 794.38774 |
| SMILES | [H][C@@]12CC[C@H](C[C@@](C)(O)[C@@]3(O)[C@@H]4O[C@]5(c6ccccc6)O[C@H]3[C@@H](C)[C@@]3(O5)[C@@]4([H])[C@@H]4O[C@]4(CO)[C@@H](O)[C@]4(O)[C@@H](OC(=O)/C=C/C=C\[C@H]1OC(=O)CC(C)C)[C@@H](C)C[C@]43[H])[C@@H]2C |
| InChI | InChI=1S/C44H58O13/c1-22(2)18-32(47)52-29-14-10-11-15-31(46)53-34-23(3)19-30-41(34,50)38(48)40(21-45)36(54-40)33-37-43(51,39(6,49)20-26-16-17-28(29)24(26)4)35-25(5)42(30,33)57-44(55-35,56-37)27-12-8-7-9-13-27/h7-15,22-26,28-30,33-38,45,48-51H,16-21H2,1-6H3/b14-10-,15-11+/t23-,24-,25+,26+,28-,29+,30+,33-,34-,35-,36-,37+,38+,39+,40-,41+,42-,43-,44-/m0/s1 |
| InChIKey | ZAVYYYQORHVVFN-GONPTSPMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon reidioides (IPNI:358060-1) | root (BTO:0001188) | PubMed (16204992) | |
| Trigonostemon thyrsoideum (ncbitaxon:289660) | root (BTO:0001188) | PubMed (21192108) | Methanolic extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rediocide A (CHEBI:66292) has role insecticide (CHEBI:24852) |
| rediocide A (CHEBI:66292) has role metabolite (CHEBI:25212) |
| rediocide A (CHEBI:66292) is a diterpenoid (CHEBI:23849) |
| rediocide A (CHEBI:66292) is a epoxide (CHEBI:32955) |
| rediocide A (CHEBI:66292) is a ortho ester (CHEBI:71989) |
| rediocide A (CHEBI:66292) is a terpene lactone (CHEBI:37668) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8671429 | Reaxys |
| Citations |
|---|