EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO3 |
| Net Charge | 0 |
| Average Mass | 259.305 |
| Monoisotopic Mass | 259.12084 |
| SMILES | C/C=C/C=C/C=C(C)/C=C/C(O)=C1\C(=O)CNC1=O |
| InChI | InChI=1S/C15H17NO3/c1-3-4-5-6-7-11(2)8-9-12(17)14-13(18)10-16-15(14)19/h3-9,17H,10H2,1-2H3,(H,16,19)/b4-3+,6-5+,9-8+,11-7+,14-12- |
| InChIKey | JJFGJQNWIJPCAN-AJOOJNDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (12350167) |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z)-ravenic acid (CHEBI:66291) has role Penicillium metabolite (CHEBI:76964) |
| (3Z)-ravenic acid (CHEBI:66291) has role antibacterial agent (CHEBI:33282) |
| (3Z)-ravenic acid (CHEBI:66291) is a enol (CHEBI:33823) |
| (3Z)-ravenic acid (CHEBI:66291) is a polyene antibiotic (CHEBI:26177) |
| (3Z)-ravenic acid (CHEBI:66291) is a pyrrolidin-2-ones (CHEBI:74223) |
| IUPAC Name |
|---|
| (3Z)-3-[(2E,4E,6E,8E)-1-hydroxy-4-methyldeca-2,4,6,8-tetraen-1-ylidene]pyrrolidine-2,4-dione |
| Synonym | Source |
|---|---|
| ravenic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9275104 | Reaxys |
| Citations |
|---|