EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36N4O9 |
| Net Charge | 0 |
| Average Mass | 488.538 |
| Monoisotopic Mass | 488.24823 |
| SMILES | CC(C)CC(NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C)C(N)=O)[C@@H](C)O)[C@@H](C)O)C(=O)C1(CO)CO1 |
| InChI | InChI=1S/C21H36N4O9/c1-9(2)6-13(16(29)21(7-26)8-34-21)23-19(32)14(11(4)27)25-20(33)15(12(5)28)24-18(31)10(3)17(22)30/h9-15,26-28H,6-8H2,1-5H3,(H2,22,30)(H,23,32)(H,24,31)(H,25,33)/t10-,11-,12-,13?,14+,15+,21?/m1/s1 |
| InChIKey | SCVCWUHUBWSKHS-CRHDNEEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (11099231) | Strain: TC 1087 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-89A (CHEBI:66281) has role antimicrobial agent (CHEBI:33281) |
| TMC-89A (CHEBI:66281) has role bacterial metabolite (CHEBI:76969) |
| TMC-89A (CHEBI:66281) has role proteasome inhibitor (CHEBI:52726) |
| TMC-89A (CHEBI:66281) is a dicarboxylic acid diamide (CHEBI:35779) |
| TMC-89A (CHEBI:66281) is a epoxide (CHEBI:32955) |
| TMC-89A (CHEBI:66281) is a ketone (CHEBI:17087) |
| TMC-89A (CHEBI:66281) is a primary alcohol (CHEBI:15734) |
| TMC-89A (CHEBI:66281) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| N-[(2R)-3-amino-2-methyl-3-oxopropanoyl]-L-threonyl-N-{1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl}-L-threoninamide |
| Citations |
|---|