EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O12 |
| Net Charge | 0 |
| Average Mass | 518.471 |
| Monoisotopic Mass | 518.14243 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC1CC(O)(C(=O)O)CC(O)C1OC(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H26O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-3,5-7,9-10,19-20,23,26-30,35H,4,8,11-12H2,(H,33,34)/b7-3+ |
| InChIKey | WPEARBZAFBYHRG-XVNBXDOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salicornia herbacea (ncbitaxon:259302) | whole plant (BTO:0001461) | PubMed (16276965) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tungtungmadic acid (CHEBI:66280) has role metabolite (CHEBI:25212) |
| Tungtungmadic acid (CHEBI:66280) is a quinic acid (CHEBI:26493) |
| Synonym | Source |
|---|---|
| 3-caffeoyl-4-dihydrocaffeoyl quinic acid | ChEBI |
| Citations |
|---|