EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H58O8 |
| Net Charge | 0 |
| Average Mass | 642.874 |
| Monoisotopic Mass | 642.41317 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@@H](C/C=C(/C)C(=C)C)C(=O)O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@]1(C)CC[C@@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C38H58O8/c1-21(2)22(3)10-11-24(33(43)46-34-32(42)31(41)28(40)20-44-34)25-14-18-38(9)27-12-13-29-35(5,6)30(45-23(4)39)16-17-36(29,7)26(27)15-19-37(25,38)8/h10,24-25,28-32,34,40-42H,1,11-20H2,2-9H3/b22-10-/t24-,25-,28-,29+,30-,31+,32-,34+,36-,37-,38+/m1/s1 |
| InChIKey | RJBCIJBIKBHZMX-MGAAYXLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma tsugae (ncbitaxon:34467) | fruit body (BTO:0000487) | PubMed (10785428) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tsugarioside C (CHEBI:66278) has parent hydride lanostane (CHEBI:20265) |
| tsugarioside C (CHEBI:66278) has role antineoplastic agent (CHEBI:35610) |
| tsugarioside C (CHEBI:66278) has role fungal metabolite (CHEBI:76946) |
| tsugarioside C (CHEBI:66278) is a acetate ester (CHEBI:47622) |
| tsugarioside C (CHEBI:66278) is a monosaccharide derivative (CHEBI:63367) |
| tsugarioside C (CHEBI:66278) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| 1-O-[(3α,23Z)-3-(acetyloxy)-24-methyl-21-oxolanosta-8,23,25-trien-21-yl]-β-D-xylopyranose |
| Manual Xrefs | Databases |
|---|---|
| C00047114 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8605255 | Reaxys |
| Citations |
|---|