EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@@](CC[C@@]4([H])[C@]35CCC[C@]4(C)C(=O)OC5)(C1)C[C@]2(C)O |
| InChI | InChI=1S/C20H30O3/c1-17-7-3-8-20(12-23-16(17)21)14(17)6-9-19-10-13(4-5-15(19)20)18(2,22)11-19/h13-15,22H,3-12H2,1-2H3/t13-,14-,15+,17+,18+,19+,20-/m1/s1 |
| InChIKey | KLMZPLYXGZZBCX-TYOHIEAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | root (BTO:0001188) | PubMed (1602302) |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tripterifordin (CHEBI:66275) has role anti-HIV agent (CHEBI:64946) |
| tripterifordin (CHEBI:66275) has role plant metabolite (CHEBI:76924) |
| tripterifordin (CHEBI:66275) is a diterpene lactone (CHEBI:49193) |
| tripterifordin (CHEBI:66275) is a kaurane diterpenoid (CHEBI:53666) |
| tripterifordin (CHEBI:66275) is a organic heteropentacyclic compound (CHEBI:38164) |
| tripterifordin (CHEBI:66275) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (5β,8α,13α)-16-hydroxy-18,20-epoxykauran-18-one |
| Synonyms | Source |
|---|---|
| Kauran-18-oic acid, 16,20-dihydroxy-, delta-lactone,(4alpha)- | ChemIDplus |
| hypodiolide A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00041947 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8587307 | Reaxys |
| CAS:139122-81-9 | ChemIDplus |
| Citations |
|---|