EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25NO3 |
| Net Charge | 0 |
| Average Mass | 363.457 |
| Monoisotopic Mass | 363.18344 |
| SMILES | COc1cc(C)cc2ccc(-c3ccc4c(c3O)[C@@H](C)N[C@H](C)C4)c(O)c12 |
| InChI | InChI=1S/C23H25NO3/c1-12-9-15-5-7-18(23(26)21(15)19(10-12)27-4)17-8-6-16-11-13(2)24-14(3)20(16)22(17)25/h5-10,13-14,24-26H,11H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | UOMMAZXPQFOUSU-ZIAGYGMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triphyophyllum peltatum (ncbitaxon:63090) | |||
| root (BTO:0001188) | PubMed (9371362) | ||
| stem (BTO:0001300) | PubMed (9371362) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dioncophylline B (CHEBI:66273) has role metabolite (CHEBI:25212) |
| Dioncophylline B (CHEBI:66273) is a isoquinolines (CHEBI:24922) |
| Dioncophylline B (CHEBI:66273) is a naphthalenes (CHEBI:25477) |
| Synonym | Source |
|---|---|
| (1R,3R)-7-(1-hydroxy-8-methoxy-6-methylnaphthalen-2-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol | ChEBI |
| Citations |
|---|