EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H66O7 |
| Net Charge | 0 |
| Average Mass | 622.928 |
| Monoisotopic Mass | 622.48085 |
| SMILES | [H][C@]1([C@H](O)CCCCCCCCCC[C@@H](O)CC2=C[C@H](C)OC2=O)CC[C@]([H])([C@]2([H])CC[C@]([H])([C@H](O)CCCCCCCCCC)O2)O1 |
| InChI | InChI=1S/C37H66O7/c1-3-4-5-6-7-11-14-17-20-31(39)33-22-24-35(43-33)36-25-23-34(44-36)32(40)21-18-15-12-9-8-10-13-16-19-30(38)27-29-26-28(2)42-37(29)41/h26,28,30-36,38-40H,3-25,27H2,1-2H3/t28-,30+,31+,32+,33+,34+,35-,36+/m0/s1 |
| InChIKey | MBABCNBNDNGODA-YVKOSWGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Asimina triloba (ncbitaxon:12953) | bark (BTO:0001301) | PubMed (1593281) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trilobacin (CHEBI:66270) has role antineoplastic agent (CHEBI:35610) |
| trilobacin (CHEBI:66270) has role plant metabolite (CHEBI:76924) |
| trilobacin (CHEBI:66270) is a butenolide (CHEBI:50523) |
| trilobacin (CHEBI:66270) is a polyketide (CHEBI:26188) |
| trilobacin (CHEBI:66270) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (5S)-3-[(2R,13R)-2,13-dihydroxy-13-{(2R,2'S,5R,5'R)-5'-[(1R)-1-hydroxyundecyl]octahydro-2,2'-bifuran-5-yl}tridecyl]-5-methylfuran-2(5H)-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031369 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7344197 | Reaxys |
| CAS:140224-67-5 | ChemIDplus |
| Citations |
|---|