EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H46N2O4 |
| Net Charge | 0 |
| Average Mass | 594.796 |
| Monoisotopic Mass | 594.34576 |
| SMILES | CCc1c(C)c2c(c(C)c1C1=C/C(=C3/C=C(c4c(C)c5c(c(C)c4CC)[C@](C)(O)C[C@@H]5C)NC3=O)C(=O)N1)[C@H](C)C[C@]2(C)O |
| InChI | InChI=1S/C38H46N2O4/c1-11-23-19(5)33-29(17(3)15-37(33,9)43)21(7)31(23)27-13-25(35(41)39-27)26-14-28(40-36(26)42)32-22(8)30-18(4)16-38(10,44)34(30)20(6)24(32)12-2/h13-14,17-18,43-44H,11-12,15-16H2,1-10H3,(H,39,41)(H,40,42)/b26-25+/t17-,18+,37+,38- |
| InChIKey | BIILLAVODXFDEL-NBGPHLIOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trikentrion laeve (WORMS:167953) | - | DOI (10.1016/0040-4039(94)85027-5) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trikendiol (CHEBI:66269) has role animal metabolite (CHEBI:75767) |
| trikendiol (CHEBI:66269) has role anti-HIV-1 agent (CHEBI:64947) |
| trikendiol (CHEBI:66269) has role marine metabolite (CHEBI:76507) |
| trikendiol (CHEBI:66269) is a diol (CHEBI:23824) |
| trikendiol (CHEBI:66269) is a pyrroline (CHEBI:23763) |
| trikendiol (CHEBI:66269) is a tertiary alcohol (CHEBI:26878) |
| trikendiol (CHEBI:66269) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| (3E)-5-[(1R,3S)-6-ethyl-1-hydroxy-1,3,4,7-tetramethyl-2,3-dihydro-1H-inden-5-yl]-3-{5-[(1S,3R)-6-ethyl-1-hydroxy-1,3,4,7-tetramethyl-2,3-dihydro-1H-inden-5-yl]-2-oxo-1,2-dihydro-3H-pyrrol-3-ylidene}-1,3-dihydro-2H-pyrrol-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6948933 | Reaxys |