EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O5 |
| Net Charge | 0 |
| Average Mass | 244.202 |
| Monoisotopic Mass | 244.03717 |
| SMILES | O=c1c2cccc(O)c2oc2ccc(O)c(O)c12 |
| InChI | InChI=1S/C13H8O5/c14-7-4-5-9-10(12(7)17)11(16)6-2-1-3-8(15)13(6)18-9/h1-5,14-15,17H |
| InChIKey | WRYMABXVDKBFIK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia subelliptica (ncbitaxon:212238) | xylem (BTO:0001468) | DOI (10.1016/S0031-9422(00)97103-6) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,5-trihydroxyxanthone (CHEBI:66268) has role metabolite (CHEBI:25212) |
| 1,2,5-trihydroxyxanthone (CHEBI:66268) is a polyphenol (CHEBI:26195) |
| 1,2,5-trihydroxyxanthone (CHEBI:66268) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,2,5-trihydroxy-9H-xanthen-9-one |
| Manual Xrefs | Databases |
|---|---|
| 8235916 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6811158 | Reaxys |
| Citations |
|---|