EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O5 |
| Net Charge | 0 |
| Average Mass | 314.337 |
| Monoisotopic Mass | 314.11542 |
| SMILES | COc1c(C)c(O)c(C)c(O)c1C(=O)/C=C/c1ccccc1O |
| InChI | InChI=1S/C18H18O5/c1-10-16(21)11(2)18(23-3)15(17(10)22)14(20)9-8-12-6-4-5-7-13(12)19/h4-9,19,21-22H,1-3H3/b9-8+ |
| InChIKey | SPWBEELZNSXNME-CMDGGOBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistocalyx operculatus (IPNI:82151-3) | flower bud (BTO:0000470) | DOI (10.1021/np1002753) | Combined methanolic extract of dried buds |
| Psorothamnus polydenius (ncbitaxon:248535) | |||
| twig (BTO:0001411) | PubMed (15679330) | ||
| flower (BTO:0000469) | PubMed (15679330) | ||
| leaf (BTO:0000713) | PubMed (15679330) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:66265) has role antileishmanial agent (CHEBI:70868) |
| 2,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:66265) has role metabolite (CHEBI:25212) |
| 2,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:66265) has role trypanocidal drug (CHEBI:36335) |
| 2,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:66265) is a chalcones (CHEBI:23086) |
| 2,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:66265) is a monomethoxybenzene (CHEBI:25235) |
| 2,2',4'-trihydroxy-6'-methoxy-3',5'-dimethylchalcone (CHEBI:66265) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E)-1-(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10194818 | Reaxys |
| Citations |
|---|