EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H52N2O8S |
| Net Charge | 0 |
| Average Mass | 684.896 |
| Monoisotopic Mass | 684.34444 |
| SMILES | COC1/C=C/C=C/C=C/CC(OC(=O)C(C)NC(=O)C2CCCCC2)C(C)C(O)/C(C)=C\CCc2cc(O)c(SC)c(c2O)NC(=O)C1 |
| InChI | InChI=1S/C37H52N2O8S/c1-23-15-14-18-27-21-29(40)35(48-5)32(34(27)43)39-31(41)22-28(46-4)19-12-7-6-8-13-20-30(24(2)33(23)42)47-37(45)25(3)38-36(44)26-16-10-9-11-17-26/h6-8,12-13,15,19,21,24-26,28,30,33,40,42-43H,9-11,14,16-18,20,22H2,1-5H3,(H,38,44)(H,39,41)/b7-6+,13-8+,19-12+,23-15- |
| InChIKey | JYAJEGBJMODZBK-GTRHLNJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (17917237) | Strain: AC 654 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trierixin (CHEBI:66262) has role antimicrobial agent (CHEBI:33281) |
| trierixin (CHEBI:66262) has role antineoplastic agent (CHEBI:35610) |
| trierixin (CHEBI:66262) has role metabolite (CHEBI:25212) |
| trierixin (CHEBI:66262) is a aryl sulfide (CHEBI:35683) |
| trierixin (CHEBI:66262) is a carboxylic ester (CHEBI:33308) |
| trierixin (CHEBI:66262) is a ether (CHEBI:25698) |
| trierixin (CHEBI:66262) is a hydroquinones (CHEBI:24646) |
| trierixin (CHEBI:66262) is a lactam (CHEBI:24995) |
| trierixin (CHEBI:66262) is a macrocycle (CHEBI:51026) |
| trierixin (CHEBI:66262) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (6E,8E,10E,16Z)-15,22,24-trihydroxy-5-methoxy-14,16-dimethyl-23-(methylsulfanyl)-3-oxo-2-azabicyclo[18.3.1]tetracosa-1(24),6,8,10,16,20,22-heptaen-13-yl N-(cyclohexylcarbonyl)alaninate |
| Citations |
|---|