EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O8 |
| Net Charge | 0 |
| Average Mass | 496.556 |
| Monoisotopic Mass | 496.20972 |
| SMILES | [H][C@]12C(C(=O)/C=C/C=C/C)=C(O)[C@]3(C)[C@@]4(O)O[C@]5(C)[C@](O)(O[C@]41C)[C@@]2(C)C(O)=C(C(=O)/C=C/C=C/C)[C@@]53[H] |
| InChI | InChI=1S/C28H32O8/c1-7-9-11-13-15(29)17-19-23(3)22(32)18(16(30)14-12-10-8-2)20-24(4,21(17)31)28(34)25(19,5)35-27(23,33)26(20,6)36-28/h7-14,19-20,31-34H,1-6H3/b9-7+,10-8+,13-11+,14-12+/t19-,20-,23-,24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | VATYWOIGKMMCMM-OXGNLDDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (8626236) | Strain: V 39673 |
| Trichoderma longibrachiatum (ncbitaxon:5548) | - | Article (CAN J CHEM, 1992, 70, 10, 2526) |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichodimerol (CHEBI:66261) has role Penicillium metabolite (CHEBI:76964) |
| trichodimerol (CHEBI:66261) has role antineoplastic agent (CHEBI:35610) |
| trichodimerol (CHEBI:66261) is a cyclic ether (CHEBI:37407) |
| trichodimerol (CHEBI:66261) is a enone (CHEBI:51689) |
| trichodimerol (CHEBI:66261) is a organic heterotetracyclic compound (CHEBI:38163) |
| Synonym | Source |
|---|---|
| BMS-182123 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7609100 | Reaxys |
| Citations |
|---|