EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O9 |
| Net Charge | 0 |
| Average Mass | 412.435 |
| Monoisotopic Mass | 412.17333 |
| SMILES | CCCCCCCCCC1=COC2(CC(C(=O)O)C(CC(=O)O)(C(=O)O)O2)C1=O |
| InChI | InChI=1S/C20H28O9/c1-2-3-4-5-6-7-8-9-13-12-28-20(16(13)23)10-14(17(24)25)19(29-20,18(26)27)11-15(21)22/h12,14H,2-11H2,1H3,(H,21,22)(H,24,25)(H,26,27) |
| InChIKey | LQLCHKHILFZNKF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces trachyspermus (ncbitaxon:28566) | - | PubMed (7797435) | Strain: SANK 12191 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 3.2.1.166 (heparanase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of heparanase (EC 3.2.1.166). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trachyspic acid (CHEBI:66260) has role EC 3.2.1.166 (heparanase) inhibitor (CHEBI:64955) |
| trachyspic acid (CHEBI:66260) has role fungal metabolite (CHEBI:76946) |
| trachyspic acid (CHEBI:66260) is a oxaspiro compound (CHEBI:37948) |
| trachyspic acid (CHEBI:66260) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| 2-(carboxymethyl)-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| Trachyspic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7318108 | Reaxys |
| CAS:149718-37-6 | ChemIDplus |
| Citations |
|---|