EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H74O18 |
| Net Charge | 0 |
| Average Mass | 903.069 |
| Monoisotopic Mass | 902.48752 |
| SMILES | [H][C@@]12C[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@H]3O)[C@@]3([H])CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@](O)(CC[C@H](C)CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C45H74O18/c1-18(17-57-40-36(53)35(52)33(50)29(16-46)61-40)7-12-45(56)19(2)30-28(63-45)15-25-23-14-27(26-13-22(47)8-10-43(26,5)24(23)9-11-44(25,30)6)60-42-38(55)39(32(49)21(4)59-42)62-41-37(54)34(51)31(48)20(3)58-41/h18-21,23-42,46,48-56H,7-17H2,1-6H3/t18-,19-,20-,21+,23+,24-,25-,26+,27-,28-,29+,30-,31-,32+,33+,34+,35-,36+,37+,38+,39-,40+,41-,42-,43+,44-,45+/m0/s1 |
| InChIKey | DPXGNIHBGKCXMA-GXBWQGRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum torvum (ncbitaxon:119830) | fruit (BTO:0000486) | PubMed (11830167) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torvoside H (CHEBI:66259) has role antiviral agent (CHEBI:22587) |
| torvoside H (CHEBI:66259) has role metabolite (CHEBI:25212) |
| torvoside H (CHEBI:66259) is a 3-oxo-5α-steroid (CHEBI:13601) |
| torvoside H (CHEBI:66259) is a cyclic hemiketal (CHEBI:59780) |
| torvoside H (CHEBI:66259) is a disaccharide derivative (CHEBI:63353) |
| torvoside H (CHEBI:66259) is a pentacyclic triterpenoid (CHEBI:25872) |
| torvoside H (CHEBI:66259) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (5α,6α,22R,25S)-6-{[6-deoxy-3-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}-22-hydroxy-3-oxofurostan-26-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (25S)-26-O-(β-D-glucopyranosyl)-6α,26-dihydroxy-5α-spirostan-3-one 6-O-[α-L-rhamnopyranosyl-(1→3)-β-D-quinovopyranoside] | ChEBI |
| Citations |
|---|