EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H74O18 |
| Net Charge | 0 |
| Average Mass | 903.069 |
| Monoisotopic Mass | 902.48752 |
| SMILES | [H][C@@]12C[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@H]3O)[C@@]3([H])CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@](O)(CC[C@H](C)CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C45H74O18/c1-18(17-57-40-36(53)35(52)33(50)29(16-46)61-40)7-12-45(56)19(2)30-28(63-45)15-25-23-14-27(26-13-22(47)8-10-43(26,5)24(23)9-11-44(25,30)6)60-42-38(55)39(32(49)21(4)59-42)62-41-37(54)34(51)31(48)20(3)58-41/h18-21,23-42,46,48-56H,7-17H2,1-6H3/t18-,19-,20-,21+,23+,24-,25-,26+,27-,28-,29+,30-,31-,32+,33+,34+,35-,36+,37+,38+,39-,40+,41-,42-,43+,44-,45+/m0/s1 |
| InChIKey | DPXGNIHBGKCXMA-GXBWQGRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum torvum (ncbitaxon:119830) | fruit (BTO:0000486) | PubMed (11830167) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torvoside H (CHEBI:66259) has role antiviral agent (CHEBI:22587) |
| torvoside H (CHEBI:66259) has role metabolite (CHEBI:25212) |
| torvoside H (CHEBI:66259) is a 3-oxo-5α-steroid (CHEBI:13601) |
| torvoside H (CHEBI:66259) is a cyclic hemiketal (CHEBI:59780) |
| torvoside H (CHEBI:66259) is a disaccharide derivative (CHEBI:63353) |
| torvoside H (CHEBI:66259) is a pentacyclic triterpenoid (CHEBI:25872) |
| torvoside H (CHEBI:66259) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (5α,6α,22R,25S)-6-{[6-deoxy-3-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}-22-hydroxy-3-oxofurostan-26-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (25S)-26-O-(β-D-glucopyranosyl)-6α,26-dihydroxy-5α-spirostan-3-one 6-O-[α-L-rhamnopyranosyl-(1→3)-β-D-quinovopyranoside] | ChEBI |
| Citations |
|---|