EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19O10S.K |
| Net Charge | 0 |
| Average Mass | 490.527 |
| Monoisotopic Mass | 490.03360 |
| SMILES | COc1ccc2c(c1)[C@@H](OS(=O)(=O)[O-])[C@H](c1cc(/C=C/C(=O)O)cc(OC)c1O)CO2.[K+] |
| InChI | InChI=1S/C20H20O10S.K/c1-27-12-4-5-16-14(9-12)20(30-31(24,25)26)15(10-29-16)13-7-11(3-6-18(21)22)8-17(28-2)19(13)23;/h3-9,15,20,23H,10H2,1-2H3,(H,21,22)(H,24,25,26);/q;+1/p-1/b6-3+;/t15-,20+;/m0./s1 |
| InChIKey | OYAPXMLXMKSIDT-WSCZMHPESA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum torvum (ncbitaxon:119830) | fruit (BTO:0000486) | PubMed (11830167) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torvanol A (CHEBI:66258) has part torvanol A(1−) (CHEBI:83882) |
| torvanol A (CHEBI:66258) has role anti-HSV-1 agent (CHEBI:64953) |
| torvanol A (CHEBI:66258) has role plant metabolite (CHEBI:76924) |
| torvanol A (CHEBI:66258) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| rel-potassium (3R,4S)-3-{5-[(E)-2-carboxyethenyl]-2-hydroxy-3-methoxyphenyl}-6-methoxy-3,4-dihydro-2H-chromen-4-yl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9178609 | Reaxys |
| Citations |
|---|