EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O5 |
| Net Charge | 0 |
| Average Mass | 456.623 |
| Monoisotopic Mass | 456.28757 |
| SMILES | [H][C@]12CC[C@]3(C)Oc4ccc(C(=O)OC)cc4C[C@@]3([H])[C@]1(C)C[C@@H](O)[C@@]1([H])C(C)(C)CC[C@@H](O)[C@]21C |
| InChI | InChI=1S/C28H40O5/c1-25(2)11-10-22(30)28(5)20-9-12-27(4)21(26(20,3)15-18(29)23(25)28)14-17-13-16(24(31)32-6)7-8-19(17)33-27/h7-8,13,18,20-23,29-30H,9-12,14-15H2,1-6H3/t18-,20+,21+,22-,23+,26-,27+,28+/m1/s1 |
| InChIKey | NQNQLGPYASRQND-KNFPFGBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tolypothrix nodosa (ncbitaxon:882386) | - | PubMed (8792625) | Strain: HT 58-2 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolypodiol (CHEBI:66251) has role anti-inflammatory agent (CHEBI:67079) |
| tolypodiol (CHEBI:66251) has role metabolite (CHEBI:25212) |
| tolypodiol (CHEBI:66251) is a diol (CHEBI:23824) |
| tolypodiol (CHEBI:66251) is a diterpenoid (CHEBI:23849) |
| tolypodiol (CHEBI:66251) is a methyl ester (CHEBI:25248) |
| tolypodiol (CHEBI:66251) is a organic heteropentacyclic compound (CHEBI:38164) |
| tolypodiol (CHEBI:66251) is a oxacycle (CHEBI:38104) |
| tolypodiol (CHEBI:66251) is a polycyclic ether (CHEBI:36468) |
| tolypodiol (CHEBI:66251) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| methyl (4R,4aR,4bS,6aS,12aS,12bR,14R,14aS)-4,14-dihydroxy-1,1,4a,6a,12b-pentamethyl-2,3,4,4a,4b,5,6,6a,12,12a,12b,13,14,14a-tetradecahydro-1H-naphtho[2,1-a]xanthene-10-carboxylate |
| Synonyms | Source |
|---|---|
| 16,24-Cyclo-D(17a)-homo-21-nor-17a-oxachola-16,20(22),23-triene-23-carboxylic acid, 1,6-dihydroxy-4,4,8-trimethyl-,methyl ester, (1beta,5alpha,6beta)- | ChEBI |
| 1H-Naphtho(2,1-a)xanthene-10-carboxylic acid,2,3,4,4a,4b,5,6,6a,12,12a,12b,13,14,14a-tetradecahydro-4,14-dihydroxy-1,1,4a,6a,12b-pentamethyl-, methyl ester,(4R,4aR,4bS,6aS,12aS,12bR,14R,14aS)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7726367 | Reaxys |
| CAS:178948-67-9 | ChemIDplus |
| Citations |
|---|