EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32N2O6 |
| Net Charge | 0 |
| Average Mass | 372.462 |
| Monoisotopic Mass | 372.22604 |
| SMILES | CC(C)CC(=O)N[C@H](C(=O)NC(CC(C)C)C(=O)C1(CO)CO1)[C@@H](C)O |
| InChI | InChI=1S/C18H32N2O6/c1-10(2)6-13(16(24)18(8-21)9-26-18)19-17(25)15(12(5)22)20-14(23)7-11(3)4/h10-13,15,21-22H,6-9H2,1-5H3,(H,19,25)(H,20,23)/t12-,13?,15+,18?/m1/s1 |
| InChIKey | CEWYDURMTVVVNH-QMOGDXDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharothrix (ncbitaxon:2071) | - | PubMed (10695669) | Strain: TC 1094 |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-96 (CHEBI:66244) has role antimicrobial agent (CHEBI:33281) |
| TMC-96 (CHEBI:66244) has role antineoplastic agent (CHEBI:35610) |
| TMC-96 (CHEBI:66244) has role bacterial metabolite (CHEBI:76969) |
| TMC-96 (CHEBI:66244) has role proteasome inhibitor (CHEBI:52726) |
| TMC-96 (CHEBI:66244) is a epoxide (CHEBI:32955) |
| TMC-96 (CHEBI:66244) is a ketone (CHEBI:17087) |
| TMC-96 (CHEBI:66244) is a monocarboxylic acid amide (CHEBI:29347) |
| TMC-96 (CHEBI:66244) is a primary alcohol (CHEBI:15734) |
| TMC-96 (CHEBI:66244) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| N-{1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl}-N2-(3-methylbutanoyl)-L-threoninamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8508507 | Reaxys |
| Citations |
|---|