EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N4O5 |
| Net Charge | 0 |
| Average Mass | 406.483 |
| Monoisotopic Mass | 406.22162 |
| SMILES | NCCCCNCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)C1OC1C(=O)O |
| InChI | InChI=1S/C20H30N4O5/c21-9-4-5-10-22-11-6-12-23-18(25)15(13-14-7-2-1-3-8-14)24-19(26)16-17(29-16)20(27)28/h1-3,7-8,15-17,22H,4-6,9-13,21H2,(H,23,25)(H,24,26)(H,27,28)/t15-,16?,17?/m0/s1 |
| InChIKey | LYAOVDVXUUARTK-GTPINHCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gliocladium (ncbitaxon:62887) | - | PubMed (9727388) | Strain: F 2665 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 3.4.22.2 (papain) inhibitor A cysteine protease inhibitor which inhibits papain (EC 3.4.22.2). cathepsin L (EC 3.4.22.15) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor which interferes with the action of cathepsin L (EC 3.4.22.15). cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-52C (CHEBI:66240) has role antimicrobial agent (CHEBI:33281) |
| TMC-52C (CHEBI:66240) has role cathepsin B inhibitor (CHEBI:64932) |
| TMC-52C (CHEBI:66240) has role cathepsin L (EC 3.4.22.15) inhibitor (CHEBI:70821) |
| TMC-52C (CHEBI:66240) has role EC 3.4.22.2 (papain) inhibitor (CHEBI:70822) |
| TMC-52C (CHEBI:66240) has role fungal metabolite (CHEBI:76946) |
| TMC-52C (CHEBI:66240) is a dicarboxylic acid monoamide (CHEBI:35735) |
| TMC-52C (CHEBI:66240) is a epoxide (CHEBI:32955) |
| TMC-52C (CHEBI:66240) is a monocarboxylic acid (CHEBI:25384) |
| TMC-52C (CHEBI:66240) is a primary amino compound (CHEBI:50994) |
| TMC-52C (CHEBI:66240) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (2R*,3R*)-3-{[(2S)-1-({3-[(4-aminobutyl)amino]propyl}amino)-1-oxo-3-phenylpropan-2-yl]carbamoyl}oxirane-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8169550 | Reaxys |
| Citations |
|---|