EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N4O6 |
| Net Charge | 0 |
| Average Mass | 422.482 |
| Monoisotopic Mass | 422.21653 |
| SMILES | NCCCNCCCCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C1OC1C(=O)O |
| InChI | InChI=1S/C20H30N4O6/c21-8-3-10-22-9-1-2-11-23-18(26)15(12-13-4-6-14(25)7-5-13)24-19(27)16-17(30-16)20(28)29/h4-7,15-17,22,25H,1-3,8-12,21H2,(H,23,26)(H,24,27)(H,28,29)/t15-,16?,17?/m0/s1 |
| InChIKey | MQQOZPYNKMAOLT-GTPINHCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gliocladium (ncbitaxon:62887) | - | PubMed (9727388) | Strain: F 2665 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cathepsin L (EC 3.4.22.15) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor which interferes with the action of cathepsin L (EC 3.4.22.15). cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.22.2 (papain) inhibitor A cysteine protease inhibitor which inhibits papain (EC 3.4.22.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-52B (CHEBI:66239) has role antimicrobial agent (CHEBI:33281) |
| TMC-52B (CHEBI:66239) has role cathepsin B inhibitor (CHEBI:64932) |
| TMC-52B (CHEBI:66239) has role cathepsin L (EC 3.4.22.15) inhibitor (CHEBI:70821) |
| TMC-52B (CHEBI:66239) has role EC 3.4.22.2 (papain) inhibitor (CHEBI:70822) |
| TMC-52B (CHEBI:66239) has role metabolite (CHEBI:25212) |
| TMC-52B (CHEBI:66239) is a epoxide (CHEBI:32955) |
| TMC-52B (CHEBI:66239) is a monocarboxylic acid (CHEBI:25384) |
| TMC-52B (CHEBI:66239) is a phenols (CHEBI:33853) |
| TMC-52B (CHEBI:66239) is a primary amino compound (CHEBI:50994) |
| TMC-52B (CHEBI:66239) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (2R*,3R*)-3-{[(2S)-1-({4-[(3-aminopropyl)amino]butyl}amino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl}oxirane-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8171475 | Reaxys |
| Citations |
|---|