EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38N2O7 |
| Net Charge | 0 |
| Average Mass | 538.641 |
| Monoisotopic Mass | 538.26790 |
| SMILES | CCCCC(C)/C=C(C)/C=C/C(=O)NC1=C[C@@](O)(/C=C/C=C/C=C/C(=O)NC2=C(O)CCC2=O)[C@H](O)CC1=O |
| InChI | InChI=1S/C30H38N2O7/c1-4-5-10-20(2)17-21(3)12-15-28(38)31-22-19-30(39,26(36)18-25(22)35)16-9-7-6-8-11-27(37)32-29-23(33)13-14-24(29)34/h6-9,11-12,15-17,19-20,26,33,36,39H,4-5,10,13-14,18H2,1-3H3,(H,31,38)(H,32,37)/b7-6+,11-8+,15-12+,16-9+,21-17+/t20?,26-,30+/m1/s1 |
| InChIKey | WDPVYGCEBGDANZ-CXLBDHTJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (9031666) | Strain: A 230 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-1C (CHEBI:66236) has role antineoplastic agent (CHEBI:35610) |
| TMC-1C (CHEBI:66236) has role bacterial metabolite (CHEBI:76969) |
| TMC-1C (CHEBI:66236) is a cyclic ketone (CHEBI:3992) |
| TMC-1C (CHEBI:66236) is a enamide (CHEBI:51751) |
| TMC-1C (CHEBI:66236) is a enol (CHEBI:33823) |
| TMC-1C (CHEBI:66236) is a enone (CHEBI:51689) |
| TMC-1C (CHEBI:66236) is a polyene antibiotic (CHEBI:26177) |
| TMC-1C (CHEBI:66236) is a secondary alcohol (CHEBI:35681) |
| TMC-1C (CHEBI:66236) is a secondary carboxamide (CHEBI:140325) |
| TMC-1C (CHEBI:66236) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E,4E)-N-[(3S,4R)-3,4-dihydroxy-3-[(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trienyl]-6-oxocyclohex-1-en-1-yl]-4,6-dimethyldeca-2,4-dienamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8179148 | Reaxys |
| Citations |
|---|