EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36N2O7 |
| Net Charge | 0 |
| Average Mass | 512.603 |
| Monoisotopic Mass | 512.25225 |
| SMILES | CCC(C)CC/C=C(\C)C(=O)NC1=C[C@@](O)(/C=C/C=C/C=C/C(=O)NC2=C(O)CCC2=O)[C@H](O)CC1=O |
| InChI | InChI=1S/C28H36N2O7/c1-4-18(2)10-9-11-19(3)27(36)29-20-17-28(37,24(34)16-23(20)33)15-8-6-5-7-12-25(35)30-26-21(31)13-14-22(26)32/h5-8,11-12,15,17-18,24,31,34,37H,4,9-10,13-14,16H2,1-3H3,(H,29,36)(H,30,35)/b6-5+,12-7+,15-8+,19-11+/t18?,24-,28+/m1/s1 |
| InChIKey | LTZQMADYCMVTKI-UVJPKDHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (9031666) | Strain: A 230 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-1B (CHEBI:66235) has role antineoplastic agent (CHEBI:35610) |
| TMC-1B (CHEBI:66235) has role bacterial metabolite (CHEBI:76969) |
| TMC-1B (CHEBI:66235) is a cyclic ketone (CHEBI:3992) |
| TMC-1B (CHEBI:66235) is a enamide (CHEBI:51751) |
| TMC-1B (CHEBI:66235) is a enol (CHEBI:33823) |
| TMC-1B (CHEBI:66235) is a enone (CHEBI:51689) |
| TMC-1B (CHEBI:66235) is a polyene antibiotic (CHEBI:26177) |
| TMC-1B (CHEBI:66235) is a secondary alcohol (CHEBI:35681) |
| TMC-1B (CHEBI:66235) is a secondary carboxamide (CHEBI:140325) |
| TMC-1B (CHEBI:66235) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E)-N-[(3S,4R)-3,4-dihydroxy-3-{(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trien-1-yl}-6-oxocyclohex-1-en-1-yl]-2,6-dimethyloct-2-enamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8178597 | Reaxys |
| Citations |
|---|