EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O5 |
| Net Charge | 0 |
| Average Mass | 344.492 |
| Monoisotopic Mass | 344.25627 |
| SMILES | CCCCCCC(O)C(O)/C=C/C(O)CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H36O5/c1-3-4-5-9-12-17(21)18(22)15-14-16(20)11-8-6-7-10-13-19(23)24-2/h14-18,20-22H,3-13H2,1-2H3/b15-14+ |
| InChIKey | VAGGDCACZPJMFS-CCEZHUSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sambucus williamsii (ncbitaxon:180062) | stem (BTO:0001300) | PubMed (16651764) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tianshic acid methyl ester (CHEBI:66231) has role plant metabolite (CHEBI:76924) |
| tianshic acid methyl ester (CHEBI:66231) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (9E)-8,11,12-trihydroxyoctadec-9-enoate |
| Citations |
|---|