EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | CCCCCCC(O)C(O)/C=C/C(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-4-8-11-16(20)17(21)14-13-15(19)10-7-5-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+ |
| InChIKey | YFCZLXRIKFCQFU-BUHFOSPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aesculus wilsonii (ncbitaxon:531827) | - | Article (ACTA PHARM SIN, 2000, 35, 198) | |
| Allium fistulosum (ncbitaxon:35875) | seed (BTO:0001226) | PubMed (12381110) | |
| Ophiopogon japonicus (ncbitaxon:100506) | tuber (BTO:0001400) | Article (NAT PROD RES DEV, 2005, 17, 1) | |
| Sambucus williamsii (ncbitaxon:180062) | stem (BTO:0001300) | PubMed (16651764) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tianshic acid (CHEBI:66230) has role antifungal agent (CHEBI:35718) |
| tianshic acid (CHEBI:66230) has role plant metabolite (CHEBI:76924) |
| tianshic acid (CHEBI:66230) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| tianshic acid (CHEBI:66230) is a olefinic fatty acid (CHEBI:53339) |
| IUPAC Name |
|---|
| (9E)-8,11,12-trihydroxyoctadec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| C00032358 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9431070 | Reaxys |
| Citations |
|---|