EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H30O17 |
| Net Charge | 0 |
| Average Mass | 722.608 |
| Monoisotopic Mass | 722.14830 |
| SMILES | [H][C@@]12COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@@]1([H])[C@H](O)[C@@H](O)[C@H](Oc1cc(O)c(C(=O)CCc3ccccc3)c(O)c1)O2 |
| InChI | InChI=1S/C35H30O17/c36-17(7-6-13-4-2-1-3-5-13)25-18(37)8-14(9-19(25)38)50-35-31(46)30(45)32-22(51-35)12-49-33(47)15-10-20(39)26(41)28(43)23(15)24-16(34(48)52-32)11-21(40)27(42)29(24)44/h1-5,8-11,22,30-32,35,37-46H,6-7,12H2/t22-,30-,31-,32-,35-/m1/s1 |
| InChIKey | UJNCWORGHSATHA-XWSAIMBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thonningia sanguinea (IPNI:329935-2) | - | PubMed (10843586) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thonningianin B (CHEBI:66228) has role metabolite (CHEBI:25212) |
| Thonningianin B (CHEBI:66228) is a tannin (CHEBI:26848) |
| Citations |
|---|