EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N2O8S2 |
| Net Charge | 0 |
| Average Mass | 624.822 |
| Monoisotopic Mass | 624.25391 |
| SMILES | C/C(=C\C(=O)OCCCCCCCC(=O)Nc1c2sscc-2nc1=O)CC1CC(O)C(O)(C/C=C/C(C)C(C)O)CO1 |
| InChI | InChI=1S/C30H44N2O8S2/c1-19(14-22-16-24(34)30(38,18-40-22)12-9-10-20(2)21(3)33)15-26(36)39-13-8-6-4-5-7-11-25(35)32-27-28-23(17-41-42-28)31-29(27)37/h9-10,15,17,20-22,24,33-34,38H,4-8,11-14,16,18H2,1-3H3,(H,31,37)(H,32,35)/b10-9+,19-15+ |
| InChIKey | FCMYPMGTCIMUMZ-DJKNXTBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alteromonas rava (ncbitaxon:226) | - | PubMed (9207918) | Strain: SANK 73390 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiomarinol G (CHEBI:66226) has role antibacterial agent (CHEBI:33282) |
| thiomarinol G (CHEBI:66226) has role antimicrobial agent (CHEBI:33281) |
| thiomarinol G (CHEBI:66226) has role marine metabolite (CHEBI:76507) |
| thiomarinol G (CHEBI:66226) is a cyclic ether (CHEBI:37407) |
| thiomarinol G (CHEBI:66226) is a enoate ester (CHEBI:51702) |
| thiomarinol G (CHEBI:66226) is a lactam (CHEBI:24995) |
| thiomarinol G (CHEBI:66226) is a organosulfur heterocyclic compound (CHEBI:38106) |
| thiomarinol G (CHEBI:66226) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 1,5-anhydro-2-deoxy-4-C-[(2E)-5-hydroxy-4-methylhex-2-en-1-yl]-1-[(2E)-2-methyl-4-oxo-4-({8-oxo-8-[(5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)amino]octyl}oxy)but-2-en-1-yl]pentitol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26266354 | Reaxys |
| Citations |
|---|