EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48N2O9S2 |
| Net Charge | 0 |
| Average Mass | 668.875 |
| Monoisotopic Mass | 668.28012 |
| SMILES | [H][C@@]1([C@H](O)/C(C)=C/C(=O)OCCCCCCCCCC(=O)Nc2c3sscc-3nc2=O)OC[C@H](C/C=C/[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H48N2O9S2/c1-19(21(3)35)12-11-13-22-17-43-30(29(40)28(22)39)27(38)20(2)16-25(37)42-15-10-8-6-4-5-7-9-14-24(36)34-26-31-23(18-44-45-31)33-32(26)41/h11-12,16,18-19,21-22,27-30,35,38-40H,4-10,13-15,17H2,1-3H3,(H,33,41)(H,34,36)/b12-11+,20-16+/t19-,21+,22+,27-,28-,29-,30+/m1/s1 |
| InChIKey | DIZXGLMCRBSVBM-WCCSBUKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alteromonas rava (ncbitaxon:226) | - | PubMed (9207918) | Strain: SANK 73390 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiomarinol E (CHEBI:66224) has role antibacterial agent (CHEBI:33282) |
| thiomarinol E (CHEBI:66224) has role antimicrobial agent (CHEBI:33281) |
| thiomarinol E (CHEBI:66224) has role bacterial metabolite (CHEBI:76969) |
| thiomarinol E (CHEBI:66224) is a enoate ester (CHEBI:51702) |
| thiomarinol E (CHEBI:66224) is a lactam (CHEBI:24995) |
| thiomarinol E (CHEBI:66224) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| (5S)-1,5-anhydro-2-deoxy-2-[(2E,4R,5S)-5-hydroxy-4-methylhex-2-en-1-yl]-5-[(1R,2E)-1-hydroxy-2-methyl-4-oxo-4-({10-oxo-10-[(5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)amino]decyl}oxy)but-2-en-1-yl]-L-arabinitol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8180124 | Reaxys |
| Citations |
|---|