EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46N2O9S2 |
| Net Charge | 0 |
| Average Mass | 654.848 |
| Monoisotopic Mass | 654.26447 |
| SMILES | [H][C@@]1([C@H](O)/C(C)=C/C(=O)OCCCCCCCC(=O)Nc2c3sscc-3nc2=O)OC[C@H](C/C=C/[C@@H](C)[C@@H](O)CC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C31H46N2O9S2/c1-4-22(34)18(2)11-10-12-20-16-42-29(28(39)27(20)38)26(37)19(3)15-24(36)41-14-9-7-5-6-8-13-23(35)33-25-30-21(17-43-44-30)32-31(25)40/h10-11,15,17-18,20,22,26-29,34,37-39H,4-9,12-14,16H2,1-3H3,(H,32,40)(H,33,35)/b11-10+,19-15+/t18-,20+,22+,26-,27-,28-,29+/m1/s1 |
| InChIKey | WJDAODOGPRMXNX-ZFNRTSIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alteromonas rava (ncbitaxon:226) | - | PubMed (9207918) | Strain: SANK 73390 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiomarinol D (CHEBI:66223) has role antibacterial agent (CHEBI:33282) |
| thiomarinol D (CHEBI:66223) has role antimicrobial agent (CHEBI:33281) |
| thiomarinol D (CHEBI:66223) has role bacterial metabolite (CHEBI:76969) |
| thiomarinol D (CHEBI:66223) is a enoate ester (CHEBI:51702) |
| thiomarinol D (CHEBI:66223) is a lactam (CHEBI:24995) |
| thiomarinol D (CHEBI:66223) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| (5S)-1,5-anhydro-2-deoxy-2-[(2E,4R,5S)-5-hydroxy-4-methylhept-2-en-1-yl]-5-[(1R,2E)-1-hydroxy-2-methyl-4-oxo-4-({8-oxo-8-[(5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)amino]octyl}oxy)but-2-en-1-yl]-L-arabinitol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8179895 | Reaxys |
| Citations |
|---|