EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N2O8S2 |
| Net Charge | 0 |
| Average Mass | 624.822 |
| Monoisotopic Mass | 624.25391 |
| SMILES | [H][C@@]1(C/C(C)=C/C(=O)OCCCCCCCC(=O)Nc2c3sscc-3nc2=O)OC[C@H](C/C=C/[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H44N2O8S2/c1-18(14-23-28(37)27(36)21(16-40-23)11-9-10-19(2)20(3)33)15-25(35)39-13-8-6-4-5-7-12-24(34)32-26-29-22(17-41-42-29)31-30(26)38/h9-10,15,17,19-21,23,27-28,33,36-37H,4-8,11-14,16H2,1-3H3,(H,31,38)(H,32,34)/b10-9+,18-15+/t19-,20+,21+,23+,27-,28+/m1/s1 |
| InChIKey | KYCIRSXXQPEBCI-UYGPANRWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alteromonas rava (ncbitaxon:226) | - | PubMed (7592043) | Strain: SANK 73390 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiomarinol C (CHEBI:66222) has role antibacterial agent (CHEBI:33282) |
| thiomarinol C (CHEBI:66222) has role antimicrobial agent (CHEBI:33281) |
| thiomarinol C (CHEBI:66222) has role bacterial metabolite (CHEBI:76969) |
| thiomarinol C (CHEBI:66222) is a enoate ester (CHEBI:51702) |
| thiomarinol C (CHEBI:66222) is a lactam (CHEBI:24995) |
| thiomarinol C (CHEBI:66222) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| (5S)-1,5-anhydro-2-deoxy-2-[(2E,4R,5S)-5-hydroxy-4-methylhex-2-en-1-yl]-5-[(2E)-2-methyl-4-oxo-4-({8-oxo-8-[(5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)amino]octyl}oxy)but-2-en-1-yl]-L-arabinitol |
| Synonym | Source |
|---|---|
| [8-oxo-8-[(5-oxo-4H-dithiolo[4,3-b]pyrrol-6-yl)amino]octyl](2E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(2E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-3-methylbut-2-enoate | IUPAC |
| UniProt Name | Source |
|---|---|
| thiomarinol C | UniProt |
| Citations |
|---|