EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N2O9S2 |
| Net Charge | 0 |
| Average Mass | 640.821 |
| Monoisotopic Mass | 640.24882 |
| SMILES | [H][C@@]1([C@H](O)/C(C)=C/C(=O)OCCCCCCCC(=O)Nc2c3sscc-3nc2=O)OC[C@H](C/C=C/[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H44N2O9S2/c1-17(19(3)33)10-9-11-20-15-41-28(27(38)26(20)37)25(36)18(2)14-23(35)40-13-8-6-4-5-7-12-22(34)32-24-29-21(16-42-43-29)31-30(24)39/h9-10,14,16-17,19-20,25-28,33,36-38H,4-8,11-13,15H2,1-3H3,(H,31,39)(H,32,34)/b10-9+,18-14+/t17-,19+,20+,25-,26-,27-,28+/m1/s1 |
| InChIKey | JIEMCPGFAXNCQW-XVYZEKPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alteromonas rava (ncbitaxon:226) | - | PubMed (7592043) | Strain: SANK 73390 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiomarinol A (CHEBI:66220) has role antibacterial agent (CHEBI:33282) |
| thiomarinol A (CHEBI:66220) has role antimicrobial agent (CHEBI:33281) |
| thiomarinol A (CHEBI:66220) has role bacterial metabolite (CHEBI:76969) |
| thiomarinol A (CHEBI:66220) has role marine metabolite (CHEBI:76507) |
| thiomarinol A (CHEBI:66220) is a cyclic ether (CHEBI:37407) |
| thiomarinol A (CHEBI:66220) is a enoate ester (CHEBI:51702) |
| thiomarinol A (CHEBI:66220) is a lactam (CHEBI:24995) |
| thiomarinol A (CHEBI:66220) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| (5S)-1,5-anhydro-2-deoxy-2-[(2E,4R,5S)-5-hydroxy-4-methylhex-2-en-1-yl]-5-[(1R,2E)-1-hydroxy-2-methyl-4-oxo-4-({8-oxo-8-[(5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)amino]octyl}oxy)but-2-en-1-yl]-L-arabinitol |
| Synonym | Source |
|---|---|
| thiomarinol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:146697-04-3 | ChemIDplus |
| Citations |
|---|